C24H35N3O7 — CID 130307559
1-[(1S,2S,5S,6R,7R,8R,9S,10R,13R,14S)-6,8,9,13,14-pentahydroxy-11,11-dimethyl-5-prop-1-en-2-yl-12-(triazol-1-yl)-16-oxatetracyclo[6.6.2.01,10.02,7]hexadecan-7-yl]ethanone (PubChem CID 130307559) has the molecular formula C24H35N3O7 and a molecular weight of 477.56 g/mol. Its IUPAC name is 1-[(1S,2S,5S,6R,7R,8R,9S,10R,13R,14S)-6,8,9,13,14-pentahydroxy-11,11-dimethyl-5-prop-1-en-2-yl-12-(triazol-1-yl)-16-oxatetracyclo[6.6.2.01,10.02,7]hexadecan-7-yl]ethanone.
| Compound Name | 1-[(1S,2S,5S,6R,7R,8R,9S,10R,13R,14S)-6,8,9,13,14-pentahydroxy-11,11-dimethyl-5-prop-1-en-2-yl-12-(triazol-1-yl)-16-oxatetracyclo[6.6.2.01,10.02,7]hexadecan-7-yl]ethanone |
|---|---|
| PubChem CID | 130307559 |
| Molecular Formula | C24H35N3O7 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 1-[(1S,2S,5S,6R,7R,8R,9S,10R,13R,14S)-6,8,9,13,14-pentahydroxy-11,11-dimethyl-5-prop-1-en-2-yl-12-(triazol-1-yl)-16-oxatetracyclo[6.6.2.01,10.02,7]hexadecan-7-yl]ethanone |
| SMILES | C=C(C)[C@@H]1CC[C@H]2[C@@]34CO[C@@](O)([C@@H](O)[C@@H]3C(C)(C)C(n3ccnn3)[C@@H](O)[C@H]4O)[C@@]2(C(C)=O)[C@@H]1O |
| InChI | InChI=1S/C24H35N3O7/c1-11(2)13-6-7-14-22-10-34-24(33,23(14,12(3)28)18(13)30)20(32)16(22)21(4,5)17(15(29)19(22)31)27-9-8-25-26-27/h8-9,13-20,29-33H,1,6-7,10H2,2-5H3/t13-,14-,15+,16+,17?,18+,19+,20-,22-,23+,24-/m0/s1 |
| InChIKey | JPTDYJZPSLNUDU-BVRFFNQKSA-N |
| XLogP | -0.18 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|