C20H25NO6 — CID 130307558
(1S,5S,8R,9S,10S,18R)-9,10,18-trihydroxy-12,12-dimethylspiro[17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-ene-6,2'-aziridine]-7,15-dione (PubChem CID 130307558) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is (1S,5S,8R,9S,10S,18R)-9,10,18-trihydroxy-12,12-dimethylspiro[17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-ene-6,2'-aziridine]-7,15-dione.
| Compound Name | (1S,5S,8R,9S,10S,18R)-9,10,18-trihydroxy-12,12-dimethylspiro[17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-ene-6,2'-aziridine]-7,15-dione |
|---|---|
| PubChem CID | 130307558 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (1S,5S,8R,9S,10S,18R)-9,10,18-trihydroxy-12,12-dimethylspiro[17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadec-13-ene-6,2'-aziridine]-7,15-dione |
| SMILES | CC1(C)C=CC(=O)[C@]23CO[C@](O)([C@@H](O)C12)[C@]12C(=O)C4(CN4)[C@H](CCC31)[C@H]2O |
| InChI | InChI=1S/C20H25NO6/c1-16(2)6-5-11(22)17-8-27-20(26,14(24)12(16)17)19-10(17)4-3-9(13(19)23)18(7-21-18)15(19)25/h5-6,9-10,12-14,21,23-24,26H,3-4,7-8H2,1-2H3/t9-,10?,12?,13-,14+,17-,18?,19-,20-/m1/s1 |
| InChIKey | PVKODGUCNJEIRM-XJMFQRBJSA-N |
| XLogP | -0.85 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|