C22H27NO5S — CID 121250120
(1R,10S,11S,12R,15R,21R)-10,11,21-trihydroxy-4,8,8-trimethyl-14-methylidene-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one (PubChem CID 121250120) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is (1R,10S,11S,12R,15R,21R)-10,11,21-trihydroxy-4,8,8-trimethyl-14-methylidene-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one.
| Compound Name | (1R,10S,11S,12R,15R,21R)-10,11,21-trihydroxy-4,8,8-trimethyl-14-methylidene-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one |
|---|---|
| PubChem CID | 121250120 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (1R,10S,11S,12R,15R,21R)-10,11,21-trihydroxy-4,8,8-trimethyl-14-methylidene-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one |
| SMILES | C=C1C(=O)[C@@]23C(CC[C@H]1[C@H]2O)[C@@]12CO[C@]3(O)[C@@H](O)C1C(C)(C)Cc1sc(C)nc12 |
| InChI | InChI=1S/C22H27NO5S/c1-9-11-5-6-13-20-8-28-22(27,21(13,16(9)24)17(11)25)18(26)14(20)19(3,4)7-12-15(20)23-10(2)29-12/h11,13-14,17-18,25-27H,1,5-8H2,2-4H3/t11-,13?,14?,17-,18+,20+,21+,22-/m1/s1 |
| InChIKey | ZQUUNDRETIHFHJ-GVGXLKPXSA-N |
| XLogP | 1.49 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|