C27H32O6 — CID 162867887
4-(3,5-dihydroxyphenyl)-9,9,13-trimethyl-18-methylidene-3,5-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecane-10,19-dione (PubChem CID 162867887) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is 4-(3,5-dihydroxyphenyl)-9,9,13-trimethyl-18-methylidene-3,5-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecane-10,19-dione.
| Compound Name | 4-(3,5-dihydroxyphenyl)-9,9,13-trimethyl-18-methylidene-3,5-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecane-10,19-dione |
|---|---|
| PubChem CID | 162867887 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 4-(3,5-dihydroxyphenyl)-9,9,13-trimethyl-18-methylidene-3,5-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadecane-10,19-dione |
| SMILES | C=C1C(=O)C23C4CC5C(C)(C)C(=O)CCC5(C)C2CCC1C3OC(c1cc(O)cc(O)c1)O4 |
| InChI | InChI=1S/C27H32O6/c1-13-17-5-6-18-26(4)8-7-20(30)25(2,3)19(26)12-21-27(18,22(13)31)23(17)33-24(32-21)14-9-15(28)11-16(29)10-14/h9-11,17-19,21,23-24,28-29H,1,5-8,12H2,2-4H3 |
| InChIKey | QXADNDKJZBIYOZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|