C25H34O5 — CID 163978970
[(4S,9R,17R)-15-hydroxy-5,5,9-trimethyl-14-methylidene-6,16-dioxo-2-pentacyclo[11.3.1.01,10.04,9.015,17]heptadecanyl] butanoate (PubChem CID 163978970) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is [(4S,9R,17R)-15-hydroxy-5,5,9-trimethyl-14-methylidene-6,16-dioxo-2-pentacyclo[11.3.1.01,10.04,9.015,17]heptadecanyl] butanoate.
| Compound Name | [(4S,9R,17R)-15-hydroxy-5,5,9-trimethyl-14-methylidene-6,16-dioxo-2-pentacyclo[11.3.1.01,10.04,9.015,17]heptadecanyl] butanoate |
|---|---|
| PubChem CID | 163978970 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [(4S,9R,17R)-15-hydroxy-5,5,9-trimethyl-14-methylidene-6,16-dioxo-2-pentacyclo[11.3.1.01,10.04,9.015,17]heptadecanyl] butanoate |
| SMILES | C=C1C2CCC3C4(C(=O)C1(O)[C@H]24)C(OC(=O)CCC)C[C@@H]1C(C)(C)C(=O)CC[C@@]31C |
| InChI | InChI=1S/C25H34O5/c1-6-7-19(27)30-18-12-16-22(3,4)17(26)10-11-23(16,5)15-9-8-14-13(2)25(29)20(14)24(15,18)21(25)28/h14-16,18,20,29H,2,6-12H2,1,3-5H3/t14?,15?,16-,18?,20-,23+,24?,25?/m1/s1 |
| InChIKey | SWRFNXWAAUIFTM-MNIDBAANSA-N |
| XLogP | 3.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|