C23H37NO4 — CID 134353353
(2R,4S,9R)-13-[(dimethylamino)methyl]-2-hydroxy-15-methoxy-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,16-dione (PubChem CID 134353353) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is (2R,4S,9R)-13-[(dimethylamino)methyl]-2-hydroxy-15-methoxy-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,16-dione.
| Compound Name | (2R,4S,9R)-13-[(dimethylamino)methyl]-2-hydroxy-15-methoxy-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,16-dione |
|---|---|
| PubChem CID | 134353353 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | (2R,4S,9R)-13-[(dimethylamino)methyl]-2-hydroxy-15-methoxy-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-6,16-dione |
| SMILES | COC1CC2(CN(C)C)CCC3C1(C2=O)[C@H](O)C[C@@H]1C(C)(C)C(=O)CC[C@@]31C |
| InChI | InChI=1S/C23H37NO4/c1-20(2)15-11-17(26)23-14(21(15,3)9-8-16(20)25)7-10-22(19(23)27,13-24(4)5)12-18(23)28-6/h14-15,17-18,26H,7-13H2,1-6H3/t14?,15-,17-,18?,21+,22?,23?/m1/s1 |
| InChIKey | OYSWKPKZVSJGCO-RNNSXSISSA-N |
| XLogP | 2.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |