C26H36O5 — CID 139048781
methyl (1R,2S,5R,10R,11S,13R)-1,2,6,6,10,13,14-heptamethyl-7,16,17-trioxotetracyclo[11.3.1.02,11.05,10]heptadec-14-ene-15-carboxylate (PubChem CID 139048781) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is methyl (1R,2S,5R,10R,11S,13R)-1,2,6,6,10,13,14-heptamethyl-7,16,17-trioxotetracyclo[11.3.1.02,11.05,10]heptadec-14-ene-15-carboxylate.
| Compound Name | methyl (1R,2S,5R,10R,11S,13R)-1,2,6,6,10,13,14-heptamethyl-7,16,17-trioxotetracyclo[11.3.1.02,11.05,10]heptadec-14-ene-15-carboxylate |
|---|---|
| PubChem CID | 139048781 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | methyl (1R,2S,5R,10R,11S,13R)-1,2,6,6,10,13,14-heptamethyl-7,16,17-trioxotetracyclo[11.3.1.02,11.05,10]heptadec-14-ene-15-carboxylate |
| SMILES | COC(=O)C1=C(C)[C@@]2(C)C[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@](C)(C1=O)C2=O |
| InChI | InChI=1S/C26H36O5/c1-14-18(20(29)31-8)19(28)26(7)21(30)24(14,5)13-16-23(4)11-10-17(27)22(2,3)15(23)9-12-25(16,26)6/h15-16H,9-13H2,1-8H3/t15-,16-,23-,24+,25-,26-/m0/s1 |
| InChIKey | PXFQBLYAGVTUGJ-GGIHGFJUSA-N |
| XLogP | 4.47 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|