C26H38O6 — CID 170990604
methyl (4aS,6aS,10R,11R,11aR,12aS,12bR)-10-hydroxy-4,4,6a,8,11,11a,12b-heptamethyl-3,9-dioxo-1,2,4a,5,6,11,12,12a-octahydrobenzo[a]xanthene-10-carboxylate (PubChem CID 170990604) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is methyl (4aS,6aS,10R,11R,11aR,12aS,12bR)-10-hydroxy-4,4,6a,8,11,11a,12b-heptamethyl-3,9-dioxo-1,2,4a,5,6,11,12,12a-octahydrobenzo[a]xanthene-10-carboxylate.
| Compound Name | methyl (4aS,6aS,10R,11R,11aR,12aS,12bR)-10-hydroxy-4,4,6a,8,11,11a,12b-heptamethyl-3,9-dioxo-1,2,4a,5,6,11,12,12a-octahydrobenzo[a]xanthene-10-carboxylate |
|---|---|
| PubChem CID | 170990604 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | methyl (4aS,6aS,10R,11R,11aR,12aS,12bR)-10-hydroxy-4,4,6a,8,11,11a,12b-heptamethyl-3,9-dioxo-1,2,4a,5,6,11,12,12a-octahydrobenzo[a]xanthene-10-carboxylate |
| SMILES | COC(=O)[C@]1(O)C(=O)C(C)=C2O[C@@]3(C)CC[C@@H]4C(C)(C)C(=O)CC[C@@]4(C)[C@@H]3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C26H38O6/c1-14-19(28)26(30,21(29)31-8)15(2)24(6)13-17-23(5)11-10-18(27)22(3,4)16(23)9-12-25(17,7)32-20(14)24/h15-17,30H,9-13H2,1-8H3/t15-,16-,17+,23-,24-,25+,26-/m1/s1 |
| InChIKey | TVCHWIIJSAMLEX-KFBPNUNUSA-N |
| XLogP | 3.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|