C28H43NO7 — CID 155525144
[(1R,2R,4R,9S,10S,11S,13S,16R)-9-(acetyloxymethyl)-11-hydroxy-2-methoxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 5-aminopentanoate (PubChem CID 155525144) has the molecular formula C28H43NO7 and a molecular weight of 505.65 g/mol. Its IUPAC name is [(1R,2R,4R,9S,10S,11S,13S,16R)-9-(acetyloxymethyl)-11-hydroxy-2-methoxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 5-aminopentanoate.
| Compound Name | [(1R,2R,4R,9S,10S,11S,13S,16R)-9-(acetyloxymethyl)-11-hydroxy-2-methoxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 5-aminopentanoate |
|---|---|
| PubChem CID | 155525144 |
| Molecular Formula | C28H43NO7 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | [(1R,2R,4R,9S,10S,11S,13S,16R)-9-(acetyloxymethyl)-11-hydroxy-2-methoxy-5,5-dimethyl-14-methylidene-15-oxo-16-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] 5-aminopentanoate |
| SMILES | C=C1C(=O)[C@]23[C@H](OC(=O)CCCCN)[C@H]1C[C@H](O)[C@H]2[C@]1(COC(C)=O)CCCC(C)(C)[C@H]1C[C@H]3OC |
| InChI | InChI=1S/C28H43NO7/c1-16-18-13-19(31)23-27(15-35-17(2)30)11-8-10-26(3,4)20(27)14-21(34-5)28(23,24(16)33)25(18)36-22(32)9-6-7-12-29/h18-21,23,25,31H,1,6-15,29H2,2-5H3/t18-,19-,20+,21+,23-,25+,27-,28+/m0/s1 |
| InChIKey | JNNWRGHHCVCWKB-PBUSWEQTSA-N |
| XLogP | 2.94 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|