C17H24O4 — CID 90670703
[(1S,2R,7S,8S)-9,9-dimethyl-3-methylidene-5-oxo-4-oxatricyclo[5.5.0.02,8]dodecan-1-yl]methyl acetate (PubChem CID 90670703) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(1S,2R,7S,8S)-9,9-dimethyl-3-methylidene-5-oxo-4-oxatricyclo[5.5.0.02,8]dodecan-1-yl]methyl acetate.
| Compound Name | [(1S,2R,7S,8S)-9,9-dimethyl-3-methylidene-5-oxo-4-oxatricyclo[5.5.0.02,8]dodecan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 90670703 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(1S,2R,7S,8S)-9,9-dimethyl-3-methylidene-5-oxo-4-oxatricyclo[5.5.0.02,8]dodecan-1-yl]methyl acetate |
| SMILES | C=C1OC(=O)C[C@H]2[C@H]3[C@@H]1[C@]2(COC(C)=O)CCCC3(C)C |
| InChI | InChI=1S/C17H24O4/c1-10-14-15-12(8-13(19)21-10)17(14,9-20-11(2)18)7-5-6-16(15,3)4/h12,14-15H,1,5-9H2,2-4H3/t12-,14+,15-,17-/m0/s1 |
| InChIKey | UWVNPDWMJGBLIZ-GUSZCTEKSA-N |
| XLogP | 3.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |