C22H36O5 — CID 122182472
[(2R,3S)-2-[(2S,3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-2-yl]-3-(hydroxymethyl)oxiran-2-yl]methyl acetate (PubChem CID 122182472) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is [(2R,3S)-2-[(2S,3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-2-yl]-3-(hydroxymethyl)oxiran-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-2-[(2S,3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-2-yl]-3-(hydroxymethyl)oxiran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 122182472 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [(2R,3S)-2-[(2S,3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyl-2,4,5,5a,7,8,9,9b-octahydro-1H-benzo[e][1]benzofuran-2-yl]-3-(hydroxymethyl)oxiran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1([C@@H]2C[C@@H]3[C@@]4(C)CCCC(C)(C)[C@@H]4CC[C@@]3(C)O2)O[C@H]1CO |
| InChI | InChI=1S/C22H36O5/c1-14(24)25-13-22(18(12-23)27-22)17-11-16-20(4)9-6-8-19(2,3)15(20)7-10-21(16,5)26-17/h15-18,23H,6-13H2,1-5H3/t15-,16+,17-,18-,20-,21+,22+/m0/s1 |
| InChIKey | GWONDNYOBDCCGQ-GROCBPGISA-N |
| XLogP | 3.47 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|