C24H36O5 — CID 102064052
[(1R,4R,9R,10S,11S,12S,13S)-11-acetyloxy-13-hydroxy-5,5,9-trimethyl-13-tetracyclo[10.2.2.01,10.04,9]hexadec-15-enyl]methyl acetate (PubChem CID 102064052) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is [(1R,4R,9R,10S,11S,12S,13S)-11-acetyloxy-13-hydroxy-5,5,9-trimethyl-13-tetracyclo[10.2.2.01,10.04,9]hexadec-15-enyl]methyl acetate.
| Compound Name | [(1R,4R,9R,10S,11S,12S,13S)-11-acetyloxy-13-hydroxy-5,5,9-trimethyl-13-tetracyclo[10.2.2.01,10.04,9]hexadec-15-enyl]methyl acetate |
|---|---|
| PubChem CID | 102064052 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [(1R,4R,9R,10S,11S,12S,13S)-11-acetyloxy-13-hydroxy-5,5,9-trimethyl-13-tetracyclo[10.2.2.01,10.04,9]hexadec-15-enyl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(O)C[C@]23C=C[C@H]1[C@@H](OC(C)=O)[C@H]2[C@]1(C)CCCC(C)(C)[C@H]1CC3 |
| InChI | InChI=1S/C24H36O5/c1-15(25)28-14-24(27)13-23-11-7-17(24)19(29-16(2)26)20(23)22(5)10-6-9-21(3,4)18(22)8-12-23/h7,11,17-20,27H,6,8-10,12-14H2,1-5H3/t17-,18+,19+,20-,22+,23+,24+/m0/s1 |
| InChIKey | NFPZTYDAHYWSIF-GVNCIOMKSA-N |
| XLogP | 4.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|