C22H34O4 — CID 10522685
[(9R,11S,16S)-16-hydroxy-16-(hydroxymethyl)-5,5,9-trimethyl-11-tetracyclo[10.2.2.01,10.04,9]hexadec-13-enyl] acetate (PubChem CID 10522685) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(9R,11S,16S)-16-hydroxy-16-(hydroxymethyl)-5,5,9-trimethyl-11-tetracyclo[10.2.2.01,10.04,9]hexadec-13-enyl] acetate.
| Compound Name | [(9R,11S,16S)-16-hydroxy-16-(hydroxymethyl)-5,5,9-trimethyl-11-tetracyclo[10.2.2.01,10.04,9]hexadec-13-enyl] acetate |
|---|---|
| PubChem CID | 10522685 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(9R,11S,16S)-16-hydroxy-16-(hydroxymethyl)-5,5,9-trimethyl-11-tetracyclo[10.2.2.01,10.04,9]hexadec-13-enyl] acetate |
| SMILES | CC(=O)OC1C2C=CC3(CCC4C(C)(C)CCC[C@@]4(C)C13)C[C@@]2(O)CO |
| InChI | InChI=1S/C22H34O4/c1-14(24)26-17-15-6-10-21(12-22(15,25)13-23)11-7-16-19(2,3)8-5-9-20(16,4)18(17)21/h6,10,15-18,23,25H,5,7-9,11-13H2,1-4H3/t15?,16?,17?,18?,20-,21?,22-/m1/s1 |
| InChIKey | SAIUPPFEWBHCNJ-UJFOSYLESA-N |
| XLogP | 3.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|