C21H32O3 — CID 160722013
(1S,2R,5R,9S,12S)-5,9-bis(hydroxymethyl)-5-methyl-13,14-dimethylidenetetracyclo[10.2.2.01,10.04,9]hexadecan-2-ol (PubChem CID 160722013) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1S,2R,5R,9S,12S)-5,9-bis(hydroxymethyl)-5-methyl-13,14-dimethylidenetetracyclo[10.2.2.01,10.04,9]hexadecan-2-ol.
| Compound Name | (1S,2R,5R,9S,12S)-5,9-bis(hydroxymethyl)-5-methyl-13,14-dimethylidenetetracyclo[10.2.2.01,10.04,9]hexadecan-2-ol |
|---|---|
| PubChem CID | 160722013 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1S,2R,5R,9S,12S)-5,9-bis(hydroxymethyl)-5-methyl-13,14-dimethylidenetetracyclo[10.2.2.01,10.04,9]hexadecan-2-ol |
| SMILES | C=C1C(=C)[C@]23CC[C@H]1CC2[C@]1(CO)CCC[C@@](C)(CO)C1C[C@H]3O |
| InChI | InChI=1S/C21H32O3/c1-13-14(2)21-8-5-15(13)9-17(21)20(12-23)7-4-6-19(3,11-22)16(20)10-18(21)24/h15-18,22-24H,1-2,4-12H2,3H3/t15-,16?,17?,18+,19-,20-,21+/m0/s1 |
| InChIKey | JKYHCBYVQYKHSD-PQSXRBLBSA-N |
| XLogP | 3.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |