C20H30O6 — CID 75220966
2,11,12,16-tetrahydroxy-9-(hydroxymethyl)-5,5-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-one (PubChem CID 75220966) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is 2,11,12,16-tetrahydroxy-9-(hydroxymethyl)-5,5-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-one.
| Compound Name | 2,11,12,16-tetrahydroxy-9-(hydroxymethyl)-5,5-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
|---|---|
| PubChem CID | 75220966 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 2,11,12,16-tetrahydroxy-9-(hydroxymethyl)-5,5-dimethyl-14-methylidenetetracyclo[11.2.1.01,10.04,9]hexadecan-15-one |
| SMILES | C=C1C(=O)C23C(O)CC4C(C)(C)CCCC4(CO)C2C(O)C(O)C1C3O |
| InChI | InChI=1S/C20H30O6/c1-9-12-13(23)14(24)15-19(8-21)6-4-5-18(2,3)10(19)7-11(22)20(15,16(9)25)17(12)26/h10-15,17,21-24,26H,1,4-8H2,2-3H3 |
| InChIKey | SDGKJIAMOVJJCS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|