C22H34O4 — CID 121448269
(1R,2R,3R,9R,12S)-2-hydroxy-3-(hydroxymethyl)-9-(methoxymethyl)-5,5-dimethyl-13-methylidenetetracyclo[10.2.2.01,10.04,9]hexadecan-14-one (PubChem CID 121448269) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is (1R,2R,3R,9R,12S)-2-hydroxy-3-(hydroxymethyl)-9-(methoxymethyl)-5,5-dimethyl-13-methylidenetetracyclo[10.2.2.01,10.04,9]hexadecan-14-one.
| Compound Name | (1R,2R,3R,9R,12S)-2-hydroxy-3-(hydroxymethyl)-9-(methoxymethyl)-5,5-dimethyl-13-methylidenetetracyclo[10.2.2.01,10.04,9]hexadecan-14-one |
|---|---|
| PubChem CID | 121448269 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | (1R,2R,3R,9R,12S)-2-hydroxy-3-(hydroxymethyl)-9-(methoxymethyl)-5,5-dimethyl-13-methylidenetetracyclo[10.2.2.01,10.04,9]hexadecan-14-one |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2[C@]1(COC)CCCC(C)(C)C1[C@H](CO)[C@H]3O |
| InChI | InChI=1S/C22H34O4/c1-13-14-6-9-22(18(13)24)16(10-14)21(12-26-4)8-5-7-20(2,3)17(21)15(11-23)19(22)25/h14-17,19,23,25H,1,5-12H2,2-4H3/t14-,15-,16?,17?,19+,21+,22-/m0/s1 |
| InChIKey | XJPJAMYHRQEGOH-FAZGRPDGSA-N |
| XLogP | 2.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|