C26H37NO5 — CID 121445019
[(5R,9S,12S)-5-ethyl-5-methyl-13-methylidene-2,14-dioxo-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate (PubChem CID 121445019) has the molecular formula C26H37NO5 and a molecular weight of 443.58 g/mol. Its IUPAC name is [(5R,9S,12S)-5-ethyl-5-methyl-13-methylidene-2,14-dioxo-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate.
| Compound Name | [(5R,9S,12S)-5-ethyl-5-methyl-13-methylidene-2,14-dioxo-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 121445019 |
| Molecular Formula | C26H37NO5 |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | [(5R,9S,12S)-5-ethyl-5-methyl-13-methylidene-2,14-dioxo-9-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate |
| SMILES | C=C1C(=O)C23CC[C@H]1CC2[C@]1(COC(=O)N2CCOCC2)CCC[C@@](C)(CC)C1CC3=O |
| InChI | InChI=1S/C26H37NO5/c1-4-24(3)7-5-8-25(16-32-23(30)27-10-12-31-13-11-27)19(24)15-21(28)26-9-6-18(14-20(25)26)17(2)22(26)29/h18-20H,2,4-16H2,1,3H3/t18-,19?,20?,24+,25-,26?/m0/s1 |
| InChIKey | MCQNOAHCMBVNCE-AGTMNOGRSA-N |
| XLogP | 4.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|