C21H30O3 — CID 121448240
(1R,5S,9S,12S)-9-butyl-5-methyl-13-methylidene-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,14-dione (PubChem CID 121448240) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (1R,5S,9S,12S)-9-butyl-5-methyl-13-methylidene-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,14-dione.
| Compound Name | (1R,5S,9S,12S)-9-butyl-5-methyl-13-methylidene-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,14-dione |
|---|---|
| PubChem CID | 121448240 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (1R,5S,9S,12S)-9-butyl-5-methyl-13-methylidene-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,14-dione |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2[C@@]1(CCCC)COC[C@@H](C)C1CC3=O |
| InChI | InChI=1S/C21H30O3/c1-4-5-7-20-12-24-11-13(2)16(20)10-18(22)21-8-6-15(9-17(20)21)14(3)19(21)23/h13,15-17H,3-12H2,1-2H3/t13-,15+,16?,17?,20+,21-/m1/s1 |
| InChIKey | ZFAPXDYQECWPLH-OFEPZUKDSA-N |
| XLogP | 3.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|