C17H26O5 — CID 10542985
(1R,4S,5R,8S,12S,13S)-1-butyl-5-methyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 10542985) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (1R,4S,5R,8S,12S,13S)-1-butyl-5-methyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,12S,13S)-1-butyl-5-methyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 10542985 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (1R,4S,5R,8S,12S,13S)-1-butyl-5-methyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | CCCC[C@@]12CC[C@H]3[C@H](C)CC[C@H]4CC(=O)O[C@H](O1)[C@]43OO2 |
| InChI | InChI=1S/C17H26O5/c1-3-4-8-16-9-7-13-11(2)5-6-12-10-14(18)19-15(20-16)17(12,13)22-21-16/h11-13,15H,3-10H2,1-2H3/t11-,12+,13+,15-,16-,17+/m1/s1 |
| InChIKey | WFEXSHFUYVONEV-KDYIVRDHSA-N |
| XLogP | 3.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|