C15H22O4 — CID 118718554
(1S,4S,5R,8S,12S,13S)-1-ethyl-5-methyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one (PubChem CID 118718554) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1S,4S,5R,8S,12S,13S)-1-ethyl-5-methyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one.
| Compound Name | (1S,4S,5R,8S,12S,13S)-1-ethyl-5-methyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one |
|---|---|
| PubChem CID | 118718554 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1S,4S,5R,8S,12S,13S)-1-ethyl-5-methyl-11,14,15-trioxatetracyclo[10.2.1.04,13.08,13]pentadecan-10-one |
| SMILES | CC[C@@]12CC[C@H]3[C@H](C)CC[C@H]4CC(=O)O[C@H](O1)[C@]43O2 |
| InChI | InChI=1S/C15H22O4/c1-3-14-7-6-11-9(2)4-5-10-8-12(16)17-13(18-14)15(10,11)19-14/h9-11,13H,3-8H2,1-2H3/t9-,10+,11+,13-,14-,15+/m1/s1 |
| InChIKey | QNOOEARUAZQAMK-BIDNSIISSA-N |
| XLogP | 2.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |