C21H26O5 — CID 10666103
(1S,4S,5R,8S,12S,13S)-5-methyl-1-(2-phenylethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 10666103) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (1S,4S,5R,8S,12S,13S)-5-methyl-1-(2-phenylethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1S,4S,5R,8S,12S,13S)-5-methyl-1-(2-phenylethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 10666103 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1S,4S,5R,8S,12S,13S)-5-methyl-1-(2-phenylethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2CC(=O)O[C@@H]3O[C@@]4(CCc5ccccc5)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C21H26O5/c1-14-7-8-16-13-18(22)23-19-21(16)17(14)10-12-20(24-19,25-26-21)11-9-15-5-3-2-4-6-15/h2-6,14,16-17,19H,7-13H2,1H3/t14-,16+,17+,19-,20-,21+/m1/s1 |
| InChIKey | NEGWVKPKTURHQB-CQAWWZBVSA-N |
| XLogP | 3.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|