C23H31NO4 — CID 10620128
(1R,4S,5R,8S,12R,13S)-1,5-dimethyl-11-(3-phenylpropyl)-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 10620128) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is (1R,4S,5R,8S,12R,13S)-1,5-dimethyl-11-(3-phenylpropyl)-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,12R,13S)-1,5-dimethyl-11-(3-phenylpropyl)-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 10620128 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (1R,4S,5R,8S,12R,13S)-1,5-dimethyl-11-(3-phenylpropyl)-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2CC(=O)N(CCCc3ccccc3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C23H31NO4/c1-16-10-11-18-15-20(25)24(14-6-9-17-7-4-3-5-8-17)21-23(18)19(16)12-13-22(2,26-21)27-28-23/h3-5,7-8,16,18-19,21H,6,9-15H2,1-2H3/t16-,18+,19+,21-,22-,23+/m1/s1 |
| InChIKey | IGHHGSMGNAAZGN-CBEKKBIVSA-N |
| XLogP | 4.07 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|