C22H30O5 — CID 121448287
(1R,3R,5S,12S)-9-butyl-3-(hydroxymethyl)-5-methyl-13-methylidene-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,8,14-trione (PubChem CID 121448287) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (1R,3R,5S,12S)-9-butyl-3-(hydroxymethyl)-5-methyl-13-methylidene-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,8,14-trione.
| Compound Name | (1R,3R,5S,12S)-9-butyl-3-(hydroxymethyl)-5-methyl-13-methylidene-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,8,14-trione |
|---|---|
| PubChem CID | 121448287 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (1R,3R,5S,12S)-9-butyl-3-(hydroxymethyl)-5-methyl-13-methylidene-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,8,14-trione |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2C1(CCCC)C(=O)OCC(C)C1[C@H](CO)C3=O |
| InChI | InChI=1S/C22H30O5/c1-4-5-7-21-16-9-14-6-8-22(16,18(24)13(14)3)19(25)15(10-23)17(21)12(2)11-27-20(21)26/h12,14-17,23H,3-11H2,1-2H3/t12?,14-,15-,16?,17?,21?,22-/m0/s1 |
| InChIKey | FHCFURCYEWZHBU-FEXAIMPISA-N |
| XLogP | 2.70 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|