C23H29ClO5 — CID 121444827
[(1S,4S,7R,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 3-chloropropanoate (PubChem CID 121444827) has the molecular formula C23H29ClO5 and a molecular weight of 420.93 g/mol. Its IUPAC name is [(1S,4S,7R,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 3-chloropropanoate.
| Compound Name | [(1S,4S,7R,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 3-chloropropanoate |
|---|---|
| PubChem CID | 121444827 |
| Molecular Formula | C23H29ClO5 |
| Molecular Weight | 420.93 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [(1S,4S,7R,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 3-chloropropanoate |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2[C@@]12CCC[C@@](C)(COC1=O)C2C[C@H]3OC(=O)CCCl |
| InChI | InChI=1S/C23H29ClO5/c1-13-14-4-8-23(19(13)26)16(10-14)22-7-3-6-21(2,12-28-20(22)27)15(22)11-17(23)29-18(25)5-9-24/h14-17H,1,3-12H2,2H3/t14-,15?,16?,17+,21-,22-,23+/m0/s1 |
| InChIKey | IKRWVTXXJGDCGQ-OEDFEBSSSA-N |
| XLogP | 3.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.93 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|