C25H35NO5 — CID 121448254
(1R,3R,12S)-9-butyl-13-methylidene-3-(morpholin-4-ylmethyl)-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,8,14-trione (PubChem CID 121448254) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is (1R,3R,12S)-9-butyl-13-methylidene-3-(morpholin-4-ylmethyl)-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,8,14-trione.
| Compound Name | (1R,3R,12S)-9-butyl-13-methylidene-3-(morpholin-4-ylmethyl)-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,8,14-trione |
|---|---|
| PubChem CID | 121448254 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | (1R,3R,12S)-9-butyl-13-methylidene-3-(morpholin-4-ylmethyl)-7-oxatetracyclo[10.2.2.01,10.04,9]hexadecane-2,8,14-trione |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2C1(CCCC)C(=O)OCCC1[C@H](CN1CCOCC1)C3=O |
| InChI | InChI=1S/C25H35NO5/c1-3-4-7-24-19(6-11-31-23(24)29)18(15-26-9-12-30-13-10-26)22(28)25-8-5-17(14-20(24)25)16(2)21(25)27/h17-20H,2-15H2,1H3/t17-,18-,19?,20?,24?,25-/m0/s1 |
| InChIKey | FGVBJMBKGYGOSF-RGGUDIMWSA-N |
| XLogP | 2.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|