C26H41NO5 — CID 121445017
[(2R,5R,9R,12S,14S)-9-ethyl-2,14-dihydroxy-5-methyl-13-methylidene-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate (PubChem CID 121445017) has the molecular formula C26H41NO5 and a molecular weight of 447.62 g/mol. Its IUPAC name is [(2R,5R,9R,12S,14S)-9-ethyl-2,14-dihydroxy-5-methyl-13-methylidene-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate.
| Compound Name | [(2R,5R,9R,12S,14S)-9-ethyl-2,14-dihydroxy-5-methyl-13-methylidene-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate |
|---|---|
| PubChem CID | 121445017 |
| Molecular Formula | C26H41NO5 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | [(2R,5R,9R,12S,14S)-9-ethyl-2,14-dihydroxy-5-methyl-13-methylidene-5-tetracyclo[10.2.2.01,10.04,9]hexadecanyl]methyl morpholine-4-carboxylate |
| SMILES | C=C1[C@H]2CCC3(C(C2)[C@]2(CC)CCC[C@@](C)(COC(=O)N4CCOCC4)C2C[C@H]3O)[C@H]1O |
| InChI | InChI=1S/C26H41NO5/c1-4-25-8-5-7-24(3,16-32-23(30)27-10-12-31-13-11-27)19(25)15-21(28)26-9-6-18(14-20(25)26)17(2)22(26)29/h18-22,28-29H,2,4-16H2,1,3H3/t18-,19?,20?,21+,22-,24-,25+,26?/m0/s1 |
| InChIKey | FPESJWLCKUCDQB-KWYBCUHMSA-N |
| XLogP | 3.76 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|