C31H37F4N3O7 — CID 10122174
(3S)-3-[[(2S)-2-[[2-(4-heptylanilino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 10122174) has the molecular formula C31H37F4N3O7 and a molecular weight of 639.64 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[2-(4-heptylanilino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[2-(4-heptylanilino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 10122174 |
| Molecular Formula | C31H37F4N3O7 |
| Molecular Weight | 639.64 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[2-(4-heptylanilino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CCCCCCCc1ccc(NC(=O)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)COc2c(F)c(F)cc(F)c2F)C(C)C)cc1 |
| InChI | InChI=1S/C31H37F4N3O7/c1-4-5-6-7-8-9-18-10-12-19(13-11-18)36-30(43)31(44)38-27(17(2)3)29(42)37-22(15-24(40)41)23(39)16-45-28-25(34)20(32)14-21(33)26(28)35/h10-14,17,22,27H,4-9,15-16H2,1-3H3,(H,36,43)(H,37,42)(H,38,44)(H,40,41)/t22-,27-/m0/s1 |
| InChIKey | RQIIIOLCSXYOBO-CUNXSJBXSA-N |
| XLogP | 4.44 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|