C26H27F4N3O7 — CID 138480034
(3S)-3-[3-[[2-(2-tert-butylanilino)-2-oxoacetyl]amino]propanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 138480034) has the molecular formula C26H27F4N3O7 and a molecular weight of 569.51 g/mol. Its IUPAC name is (3S)-3-[3-[[2-(2-tert-butylanilino)-2-oxoacetyl]amino]propanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[3-[[2-(2-tert-butylanilino)-2-oxoacetyl]amino]propanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 138480034 |
| Molecular Formula | C26H27F4N3O7 |
| Molecular Weight | 569.51 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | (3S)-3-[3-[[2-(2-tert-butylanilino)-2-oxoacetyl]amino]propanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C(=O)NCCC(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C26H27F4N3O7/c1-26(2,3)13-6-4-5-7-16(13)33-25(39)24(38)31-9-8-19(35)32-17(11-20(36)37)18(34)12-40-23-21(29)14(27)10-15(28)22(23)30/h4-7,10,17H,8-9,11-12H2,1-3H3,(H,31,38)(H,32,35)(H,33,39)(H,36,37)/t17-/m0/s1 |
| InChIKey | RKXMFDKERFXSOQ-KRWDZBQOSA-N |
| XLogP | 2.59 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|