C30H30N2O5 — CID 101221978
(1S,2S,6R,9S)-9-[(1S)-1,2-bis(phenylmethoxy)ethyl]-4-phenyl-7-oxa-4,8-diazatricyclo[6.3.0.02,6]undecane-3,5-dione (PubChem CID 101221978) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-[(1S)-1,2-bis(phenylmethoxy)ethyl]-4-phenyl-7-oxa-4,8-diazatricyclo[6.3.0.02,6]undecane-3,5-dione.
| Compound Name | (1S,2S,6R,9S)-9-[(1S)-1,2-bis(phenylmethoxy)ethyl]-4-phenyl-7-oxa-4,8-diazatricyclo[6.3.0.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 101221978 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (1S,2S,6R,9S)-9-[(1S)-1,2-bis(phenylmethoxy)ethyl]-4-phenyl-7-oxa-4,8-diazatricyclo[6.3.0.02,6]undecane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](ON3[C@H]2CC[C@H]3[C@@H](COCc2ccccc2)OCc2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C30H30N2O5/c33-29-27-25-17-16-24(32(25)37-28(27)30(34)31(29)23-14-8-3-9-15-23)26(36-19-22-12-6-2-7-13-22)20-35-18-21-10-4-1-5-11-21/h1-15,24-28H,16-20H2/t24-,25-,26+,27-,28+/m0/s1 |
| InChIKey | GDKGSWFWBJEWHO-AJIIGFCHSA-N |
| XLogP | 4.12 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|