C15H26O3 — CID 101222301
(1S,2R,5R,6S,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,5]dodecane-2,5-diol (PubChem CID 101222301) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,2R,5R,6S,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,5]dodecane-2,5-diol.
| Compound Name | (1S,2R,5R,6S,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,5]dodecane-2,5-diol |
|---|---|
| PubChem CID | 101222301 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,2R,5R,6S,9R)-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,5]dodecane-2,5-diol |
| SMILES | C[C@H]1CC[C@@H]2C[C@@]3(OC2(C)C)[C@@]1(O)CC[C@@]3(C)O |
| InChI | InChI=1S/C15H26O3/c1-10-5-6-11-9-15(18-12(11,2)3)13(4,16)7-8-14(10,15)17/h10-11,16-17H,5-9H2,1-4H3/t10-,11+,13+,14+,15-/m0/s1 |
| InChIKey | QBCJQQMMHNYFHB-JHOKLZQASA-N |
| XLogP | 2.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |