C16H24N2O4 — CID 101224558
[5-[(cyclohexylamino)methyl]furan-2-yl]methyl 4-amino-4-oxobutanoate (PubChem CID 101224558) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is [5-[(cyclohexylamino)methyl]furan-2-yl]methyl 4-amino-4-oxobutanoate.
| Compound Name | [5-[(cyclohexylamino)methyl]furan-2-yl]methyl 4-amino-4-oxobutanoate |
|---|---|
| PubChem CID | 101224558 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | [5-[(cyclohexylamino)methyl]furan-2-yl]methyl 4-amino-4-oxobutanoate |
| SMILES | NC(=O)CCC(=O)OCc1ccc(CNC2CCCCC2)o1 |
| InChI | InChI=1S/C16H24N2O4/c17-15(19)8-9-16(20)21-11-14-7-6-13(22-14)10-18-12-4-2-1-3-5-12/h6-7,12,18H,1-5,8-11H2,(H2,17,19) |
| InChIKey | ZTQPHPINMGFHLK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |