C31H35F3N6O6S — CID 10122615
3-[4-(1,1-dioxo-1,4-thiazinane-4-carboximidoyl)phenyl]-N-[2-oxo-2-[[4,4,4-trifluoro-1-(1H-indol-3-yl)-3-oxobutan-2-yl]amino]ethyl]-2-(propanoylamino)propanamide (PubChem CID 10122615) has the molecular formula C31H35F3N6O6S and a molecular weight of 676.72 g/mol. Its IUPAC name is 3-[4-(1,1-dioxo-1,4-thiazinane-4-carboximidoyl)phenyl]-N-[2-oxo-2-[[4,4,4-trifluoro-1-(1H-indol-3-yl)-3-oxobutan-2-yl]amino]ethyl]-2-(propanoylamino)propanamide.
| Compound Name | 3-[4-(1,1-dioxo-1,4-thiazinane-4-carboximidoyl)phenyl]-N-[2-oxo-2-[[4,4,4-trifluoro-1-(1H-indol-3-yl)-3-oxobutan-2-yl]amino]ethyl]-2-(propanoylamino)propanamide |
|---|---|
| PubChem CID | 10122615 |
| Molecular Formula | C31H35F3N6O6S |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.23 |
| IUPAC Name | 3-[4-(1,1-dioxo-1,4-thiazinane-4-carboximidoyl)phenyl]-N-[2-oxo-2-[[4,4,4-trifluoro-1-(1H-indol-3-yl)-3-oxobutan-2-yl]amino]ethyl]-2-(propanoylamino)propanamide |
| SMILES | [H]/N=C(/c1ccc(CC(NC(=O)CC)C(=O)NCC(=O)NC(Cc2c[nH]c3ccccc23)C(=O)C(F)(F)F)cc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C31H35F3N6O6S/c1-2-26(41)39-25(15-19-7-9-20(10-8-19)29(35)40-11-13-47(45,46)14-12-40)30(44)37-18-27(42)38-24(28(43)31(32,33)34)16-21-17-36-23-6-4-3-5-22(21)23/h3-10,17,24-25,35-36H,2,11-16,18H2,1H3,(H,37,44)(H,38,42)(H,39,41)/b35-29- |
| InChIKey | NIWIMYLHAWWOGL-MJPNWULPSA-N |
| XLogP | 1.64 |
| TPSA | 181.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|