C23H23F3N4O4S — CID 3811997
N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(1H-indol-3-yl)propanoyl]-4-(trifluoromethyl)benzohydrazide (PubChem CID 3811997) has the molecular formula C23H23F3N4O4S and a molecular weight of 508.52 g/mol. Its IUPAC name is N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(1H-indol-3-yl)propanoyl]-4-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(1H-indol-3-yl)propanoyl]-4-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 3811997 |
| Molecular Formula | C23H23F3N4O4S |
| Molecular Weight | 508.52 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(1H-indol-3-yl)propanoyl]-4-(trifluoromethyl)benzohydrazide |
| SMILES | O=C(NNC(=O)C(Cc1c[nH]c2ccccc12)N1CCS(=O)(=O)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H23F3N4O4S/c24-23(25,26)17-7-5-15(6-8-17)21(31)28-29-22(32)20(30-9-11-35(33,34)12-10-30)13-16-14-27-19-4-2-1-3-18(16)19/h1-8,14,20,27H,9-13H2,(H,28,31)(H,29,32) |
| InChIKey | ZRHBNQYWFMZGGK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|