C29H30F3N5O4S — CID 10167627
3-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-N-[2-oxo-2-[[4,4,4-trifluoro-1-(1H-indol-3-yl)-3-oxobutan-2-yl]amino]ethyl]-2-(propanoylamino)propanamide (PubChem CID 10167627) has the molecular formula C29H30F3N5O4S and a molecular weight of 601.65 g/mol. Its IUPAC name is 3-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-N-[2-oxo-2-[[4,4,4-trifluoro-1-(1H-indol-3-yl)-3-oxobutan-2-yl]amino]ethyl]-2-(propanoylamino)propanamide.
| Compound Name | 3-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-N-[2-oxo-2-[[4,4,4-trifluoro-1-(1H-indol-3-yl)-3-oxobutan-2-yl]amino]ethyl]-2-(propanoylamino)propanamide |
|---|---|
| PubChem CID | 10167627 |
| Molecular Formula | C29H30F3N5O4S |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | 3-[4-(4,5-dihydro-1,3-thiazol-2-yl)phenyl]-N-[2-oxo-2-[[4,4,4-trifluoro-1-(1H-indol-3-yl)-3-oxobutan-2-yl]amino]ethyl]-2-(propanoylamino)propanamide |
| SMILES | CCC(=O)NC(Cc1ccc(C2=NCCS2)cc1)C(=O)NCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)C(F)(F)F |
| InChI | InChI=1S/C29H30F3N5O4S/c1-2-24(38)37-23(13-17-7-9-18(10-8-17)28-33-11-12-42-28)27(41)35-16-25(39)36-22(26(40)29(30,31)32)14-19-15-34-21-6-4-3-5-20(19)21/h3-10,15,22-23,34H,2,11-14,16H2,1H3,(H,35,41)(H,36,39)(H,37,38) |
| InChIKey | XOESWXWESRWZQO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |