C27H37N2OP — CID 101227021
[(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-bis(2,4-dimethylphenyl)phosphane (PubChem CID 101227021) has the molecular formula C27H37N2OP and a molecular weight of 436.58 g/mol. Its IUPAC name is [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-bis(2,4-dimethylphenyl)phosphane.
| Compound Name | [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-bis(2,4-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 101227021 |
| Molecular Formula | C27H37N2OP |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-bis(2,4-dimethylphenyl)phosphane |
| SMILES | Cc1ccc(P(c2ccc(C)cc2C)N2CCC[C@H]2C2=N[C@H](C(C)(C)C)CO2)c(C)c1 |
| InChI | InChI=1S/C27H37N2OP/c1-18-10-12-23(20(3)15-18)31(24-13-11-19(2)16-21(24)4)29-14-8-9-22(29)26-28-25(17-30-26)27(5,6)7/h10-13,15-16,22,25H,8-9,14,17H2,1-7H3/t22-,25-/m0/s1 |
| InChIKey | BNOBYAQQQHKMBX-DHLKQENFSA-N |
| XLogP | 5.58 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|