C24H45O19P3 — CID 10123033
[3-[(2,5-dihydroxy-3,4-diphosphonooxy-6-prop-2-enoxycyclohexyl)oxy-hydroxyphosphoryl]oxy-2-hexanoyloxypropyl] hexanoate (PubChem CID 10123033) has the molecular formula C24H45O19P3 and a molecular weight of 730.53 g/mol. Its IUPAC name is [3-[(2,5-dihydroxy-3,4-diphosphonooxy-6-prop-2-enoxycyclohexyl)oxy-hydroxyphosphoryl]oxy-2-hexanoyloxypropyl] hexanoate.
| Compound Name | [3-[(2,5-dihydroxy-3,4-diphosphonooxy-6-prop-2-enoxycyclohexyl)oxy-hydroxyphosphoryl]oxy-2-hexanoyloxypropyl] hexanoate |
|---|---|
| PubChem CID | 10123033 |
| Molecular Formula | C24H45O19P3 |
| Molecular Weight | 730.53 g/mol |
| Exact Mass | 730.18 |
| IUPAC Name | [3-[(2,5-dihydroxy-3,4-diphosphonooxy-6-prop-2-enoxycyclohexyl)oxy-hydroxyphosphoryl]oxy-2-hexanoyloxypropyl] hexanoate |
| SMILES | C=CCOC1C(O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(O)C1OP(=O)(O)OCC(COC(=O)CCCCC)OC(=O)CCCCC |
| InChI | InChI=1S/C24H45O19P3/c1-4-7-9-11-17(25)38-14-16(40-18(26)12-10-8-5-2)15-39-46(35,36)43-22-20(28)24(42-45(32,33)34)23(41-44(29,30)31)19(27)21(22)37-13-6-3/h6,16,19-24,27-28H,3-5,7-15H2,1-2H3,(H,35,36)(H2,29,30,31)(H2,32,33,34) |
| InChIKey | VMZXYAFUEVXXHQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 291.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|