C11H10ClNO3 — CID 101231670
methyl 5-chloro-1-formyl-2,3-dihydroindole-3-carboxylate (PubChem CID 101231670) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is methyl 5-chloro-1-formyl-2,3-dihydroindole-3-carboxylate.
| Compound Name | methyl 5-chloro-1-formyl-2,3-dihydroindole-3-carboxylate |
|---|---|
| PubChem CID | 101231670 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | methyl 5-chloro-1-formyl-2,3-dihydroindole-3-carboxylate |
| SMILES | COC(=O)C1CN(C=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H10ClNO3/c1-16-11(15)9-5-13(6-14)10-3-2-7(12)4-8(9)10/h2-4,6,9H,5H2,1H3 |
| InChIKey | IHQSNOSGEXAJQK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|