C32H44N2Si2 — CID 101234360
N-[tert-butyl(dimethyl)silyl]-1-[2-[[tert-butyl(dimethyl)silyl]amino]naphthalen-1-yl]naphthalen-2-amine (PubChem CID 101234360) has the molecular formula C32H44N2Si2 and a molecular weight of 512.89 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]-1-[2-[[tert-butyl(dimethyl)silyl]amino]naphthalen-1-yl]naphthalen-2-amine.
| Compound Name | N-[tert-butyl(dimethyl)silyl]-1-[2-[[tert-butyl(dimethyl)silyl]amino]naphthalen-1-yl]naphthalen-2-amine |
|---|---|
| PubChem CID | 101234360 |
| Molecular Formula | C32H44N2Si2 |
| Molecular Weight | 512.89 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]-1-[2-[[tert-butyl(dimethyl)silyl]amino]naphthalen-1-yl]naphthalen-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)Nc1ccc2ccccc2c1-c1c(N[Si](C)(C)C(C)(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C32H44N2Si2/c1-31(2,3)35(7,8)33-27-21-19-23-15-11-13-17-25(23)29(27)30-26-18-14-12-16-24(26)20-22-28(30)34-36(9,10)32(4,5)6/h11-22,33-34H,1-10H3 |
| InChIKey | SWAXOUYMBTZYIZ-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.89 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|