C32H30N2O4 — CID 101234801
5,11-bis[2-(4-nitrophenyl)ethyl]tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene (PubChem CID 101234801) has the molecular formula C32H30N2O4 and a molecular weight of 506.60 g/mol. Its IUPAC name is 5,11-bis[2-(4-nitrophenyl)ethyl]tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene.
| Compound Name | 5,11-bis[2-(4-nitrophenyl)ethyl]tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
|---|---|
| PubChem CID | 101234801 |
| Molecular Formula | C32H30N2O4 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 5,11-bis[2-(4-nitrophenyl)ethyl]tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene |
| SMILES | O=[N+]([O-])c1ccc(CCc2cc3ccc2CCc2ccc(c(CCc4ccc([N+](=O)[O-])cc4)c2)CC3)cc1 |
| InChI | InChI=1S/C32H30N2O4/c35-33(36)31-17-7-23(8-18-31)1-15-29-21-25-3-11-27(29)13-5-26-4-12-28(14-6-25)30(22-26)16-2-24-9-19-32(20-10-24)34(37)38/h3-4,7-12,17-22H,1-2,5-6,13-16H2 |
| InChIKey | IIXOYBCXKRAIGD-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|