C17H22O2 — CID 101236838
5-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]benzene-1,3-diol (PubChem CID 101236838) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 5-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]benzene-1,3-diol.
| Compound Name | 5-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 101236838 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 5-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]benzene-1,3-diol |
| SMILES | CC/C=C\C/C=C\C/C=C\Cc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H22O2/c1-2-3-4-5-6-7-8-9-10-11-15-12-16(18)14-17(19)13-15/h3-4,6-7,9-10,12-14,18-19H,2,5,8,11H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | RQTVSRPYMFWJLM-PDBXOOCHSA-N |
| XLogP | 4.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|