C12H21NO — CID 101237424
(2S)-1-methyl-2-[(5-methylcyclopenten-1-yl)oxymethyl]pyrrolidine (PubChem CID 101237424) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (2S)-1-methyl-2-[(5-methylcyclopenten-1-yl)oxymethyl]pyrrolidine.
| Compound Name | (2S)-1-methyl-2-[(5-methylcyclopenten-1-yl)oxymethyl]pyrrolidine |
|---|---|
| PubChem CID | 101237424 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2S)-1-methyl-2-[(5-methylcyclopenten-1-yl)oxymethyl]pyrrolidine |
| SMILES | CC1CCC=C1OC[C@@H]1CCCN1C |
| InChI | InChI=1S/C12H21NO/c1-10-5-3-7-12(10)14-9-11-6-4-8-13(11)2/h7,10-11H,3-6,8-9H2,1-2H3/t10?,11-/m0/s1 |
| InChIKey | QKCHPSVLDQWFCO-DTIOYNMSSA-N |
| XLogP | 2.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |