C16H27NO — CID 135001583
(2S)-2-[[(5R)-5-[(E)-but-1-enyl]-5-methylcyclopenten-1-yl]oxymethyl]-1-methylpyrrolidine (PubChem CID 135001583) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (2S)-2-[[(5R)-5-[(E)-but-1-enyl]-5-methylcyclopenten-1-yl]oxymethyl]-1-methylpyrrolidine.
| Compound Name | (2S)-2-[[(5R)-5-[(E)-but-1-enyl]-5-methylcyclopenten-1-yl]oxymethyl]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 135001583 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (2S)-2-[[(5R)-5-[(E)-but-1-enyl]-5-methylcyclopenten-1-yl]oxymethyl]-1-methylpyrrolidine |
| SMILES | CC/C=C/[C@@]1(C)CCC=C1OC[C@@H]1CCCN1C |
| InChI | InChI=1S/C16H27NO/c1-4-5-10-16(2)11-6-9-15(16)18-13-14-8-7-12-17(14)3/h5,9-10,14H,4,6-8,11-13H2,1-3H3/b10-5+/t14-,16-/m0/s1 |
| InChIKey | NFELKYCTXAKDNL-YPTGLDPFSA-N |
| XLogP | 3.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|