C17H31NO — CID 168909548
2-[[(4E)-3,7-dimethylnona-4,6-dien-4-yl]oxymethyl]-1-methylpyrrolidine (PubChem CID 168909548) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 2-[[(4E)-3,7-dimethylnona-4,6-dien-4-yl]oxymethyl]-1-methylpyrrolidine.
| Compound Name | 2-[[(4E)-3,7-dimethylnona-4,6-dien-4-yl]oxymethyl]-1-methylpyrrolidine |
|---|---|
| PubChem CID | 168909548 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 2-[[(4E)-3,7-dimethylnona-4,6-dien-4-yl]oxymethyl]-1-methylpyrrolidine |
| SMILES | CCC(C)=C/C=C(/OCC1CCCN1C)C(C)CC |
| InChI | InChI=1S/C17H31NO/c1-6-14(3)10-11-17(15(4)7-2)19-13-16-9-8-12-18(16)5/h10-11,15-16H,6-9,12-13H2,1-5H3/b14-10?,17-11+ |
| InChIKey | PFBOGTFQGGMEGC-HNDRHGLDSA-N |
| XLogP | 4.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|