C13H17N2O+ — CID 101237770
5-(9-azabicyclo[4.2.1]non-2-en-2-yl)pyridin-1-ium-2-ol (PubChem CID 101237770) has the molecular formula C13H17N2O+ and a molecular weight of 217.29 g/mol. Its IUPAC name is 5-(9-azabicyclo[4.2.1]non-2-en-2-yl)pyridin-1-ium-2-ol.
| Compound Name | 5-(9-azabicyclo[4.2.1]non-2-en-2-yl)pyridin-1-ium-2-ol |
|---|---|
| PubChem CID | 101237770 |
| Molecular Formula | C13H17N2O+ |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 5-(9-azabicyclo[4.2.1]non-2-en-2-yl)pyridin-1-ium-2-ol |
| SMILES | Oc1ccc(C2=CCCC3CCC2N3)c[nH+]1 |
| InChI | InChI=1S/C13H16N2O/c16-13-7-4-9(8-14-13)11-3-1-2-10-5-6-12(11)15-10/h3-4,7-8,10,12,15H,1-2,5-6H2,(H,14,16)/p+1 |
| InChIKey | KKOWFNLNRCHGQQ-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |