C13H16N2 — CID 11074415
(1R,6R)-2-pyridin-2-yl-9-azabicyclo[4.2.1]non-2-ene (PubChem CID 11074415) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is (1R,6R)-2-pyridin-2-yl-9-azabicyclo[4.2.1]non-2-ene.
| Compound Name | (1R,6R)-2-pyridin-2-yl-9-azabicyclo[4.2.1]non-2-ene |
|---|---|
| PubChem CID | 11074415 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (1R,6R)-2-pyridin-2-yl-9-azabicyclo[4.2.1]non-2-ene |
| SMILES | C1=C(c2ccccn2)[C@H]2CC[C@@H](CC1)N2 |
| InChI | InChI=1S/C13H16N2/c1-2-9-14-12(6-1)11-5-3-4-10-7-8-13(11)15-10/h1-2,5-6,9-10,13,15H,3-4,7-8H2/t10-,13-/m1/s1 |
| InChIKey | KAFONDJFZVCZCU-ZWNOBZJWSA-N |
| XLogP | 2.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |