C14H15N — CID 143636701
2-(6-cyclopropylcyclohexa-1,5-dien-1-yl)pyridine (PubChem CID 143636701) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(6-cyclopropylcyclohexa-1,5-dien-1-yl)pyridine.
| Compound Name | 2-(6-cyclopropylcyclohexa-1,5-dien-1-yl)pyridine |
|---|---|
| PubChem CID | 143636701 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-(6-cyclopropylcyclohexa-1,5-dien-1-yl)pyridine |
| SMILES | C1=C(c2ccccn2)C(C2CC2)=CCC1 |
| InChI | InChI=1S/C14H15N/c1-2-6-13(12(5-1)11-8-9-11)14-7-3-4-10-15-14/h3-7,10-11H,1-2,8-9H2 |
| InChIKey | UJSPYHZRKJDZNT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |