C20H20N4O — CID 155421466
(10E)-1,4-dipyridin-2-yl-4a,5,6,7,8,9-hexahydrocycloocta[d]pyridazin-7-ol (PubChem CID 155421466) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is (10E)-1,4-dipyridin-2-yl-4a,5,6,7,8,9-hexahydrocycloocta[d]pyridazin-7-ol.
| Compound Name | (10E)-1,4-dipyridin-2-yl-4a,5,6,7,8,9-hexahydrocycloocta[d]pyridazin-7-ol |
|---|---|
| PubChem CID | 155421466 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (10E)-1,4-dipyridin-2-yl-4a,5,6,7,8,9-hexahydrocycloocta[d]pyridazin-7-ol |
| SMILES | OC1CC/C=C2/C(c3ccccn3)=NN=C(c3ccccn3)C2CC1 |
| InChI | InChI=1S/C20H20N4O/c25-14-6-5-7-15-16(11-10-14)20(18-9-2-4-13-22-18)24-23-19(15)17-8-1-3-12-21-17/h1-4,7-9,12-14,16,25H,5-6,10-11H2/b15-7+ |
| InChIKey | BRHKCRBBOPVNFZ-VIZOYTHASA-N |
| XLogP | 3.16 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |