C22H28N4 — CID 145053484
1,4-dipyridin-2-yl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine;ethane (PubChem CID 145053484) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1,4-dipyridin-2-yl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine;ethane.
| Compound Name | 1,4-dipyridin-2-yl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine;ethane |
|---|---|
| PubChem CID | 145053484 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1,4-dipyridin-2-yl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazine;ethane |
| SMILES | CC.c1ccc(C2=NN=C(c3ccccn3)C3CCCCCCC23)nc1 |
| InChI | InChI=1S/C20H22N4.C2H6/c1-2-4-10-16-15(9-3-1)19(17-11-5-7-13-21-17)23-24-20(16)18-12-6-8-14-22-18;1-2/h5-8,11-16H,1-4,9-10H2;1-2H3 |
| InChIKey | FNMQOXDVFQICKH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |