C21H24N6O — CID 89216906
N-(8-amino-1,4-dipyridin-2-yl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-7-yl)formamide (PubChem CID 89216906) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(8-amino-1,4-dipyridin-2-yl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-7-yl)formamide.
| Compound Name | N-(8-amino-1,4-dipyridin-2-yl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-7-yl)formamide |
|---|---|
| PubChem CID | 89216906 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | N-(8-amino-1,4-dipyridin-2-yl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-7-yl)formamide |
| SMILES | NC1CCC2C(c3ccccn3)=NN=C(c3ccccn3)C2CCC1NC=O |
| InChI | InChI=1S/C21H24N6O/c22-16-9-7-14-15(8-10-17(16)25-13-28)21(19-6-2-4-12-24-19)27-26-20(14)18-5-1-3-11-23-18/h1-6,11-17H,7-10,22H2,(H,25,28) |
| InChIKey | QUIUARYGZKINJY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|