C10H13N3O — CID 134430978
N-(1-pyridin-2-ylpyrrolidin-3-yl)formamide (PubChem CID 134430978) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is N-(1-pyridin-2-ylpyrrolidin-3-yl)formamide.
| Compound Name | N-(1-pyridin-2-ylpyrrolidin-3-yl)formamide |
|---|---|
| PubChem CID | 134430978 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-(1-pyridin-2-ylpyrrolidin-3-yl)formamide |
| SMILES | O=CNC1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C10H13N3O/c14-8-12-9-4-6-13(7-9)10-3-1-2-5-11-10/h1-3,5,8-9H,4,6-7H2,(H,12,14) |
| InChIKey | SSSMCMAQMCBNJR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|